C15H23N4O2S+ — CID 73270079
7-tert-butyl-1,3-dimethyl-5-propan-2-ylsulfanyl-4aH-pyrimido[4,5-d]pyrimidin-1-ium-2,4-dione (PubChem CID 73270079) has the molecular formula C15H23N4O2S+ and a molecular weight of 323.44 g/mol. Its IUPAC name is 7-tert-butyl-1,3-dimethyl-5-propan-2-ylsulfanyl-4aH-pyrimido[4,5-d]pyrimidin-1-ium-2,4-dione.
| Compound Name | 7-tert-butyl-1,3-dimethyl-5-propan-2-ylsulfanyl-4aH-pyrimido[4,5-d]pyrimidin-1-ium-2,4-dione |
|---|---|
| PubChem CID | 73270079 |
| Molecular Formula | C15H23N4O2S+ |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 7-tert-butyl-1,3-dimethyl-5-propan-2-ylsulfanyl-4aH-pyrimido[4,5-d]pyrimidin-1-ium-2,4-dione |
| SMILES | CC(C)SC1=NC(C(C)(C)C)=NC2=[N+](C)C(=O)N(C)C(=O)C12 |
| InChI | InChI=1S/C15H23N4O2S/c1-8(2)22-11-9-10(16-13(17-11)15(3,4)5)18(6)14(21)19(7)12(9)20/h8-9H,1-7H3/q+1 |
| InChIKey | CZZZKOINZSJHGX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 65.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|