C20H25ClN6O3 — CID 73280356
7-[(2-chlorophenyl)methyl]-3,4,9-trimethyl-1-(2-oxopropyl)-5a,9a,10,10a-tetrahydro-4H-purino[8,7-c][1,2,4]triazine-6,8-dione (PubChem CID 73280356) has the molecular formula C20H25ClN6O3 and a molecular weight of 432.91 g/mol. Its IUPAC name is 7-[(2-chlorophenyl)methyl]-3,4,9-trimethyl-1-(2-oxopropyl)-5a,9a,10,10a-tetrahydro-4H-purino[8,7-c][1,2,4]triazine-6,8-dione.
| Compound Name | 7-[(2-chlorophenyl)methyl]-3,4,9-trimethyl-1-(2-oxopropyl)-5a,9a,10,10a-tetrahydro-4H-purino[8,7-c][1,2,4]triazine-6,8-dione |
|---|---|
| PubChem CID | 73280356 |
| Molecular Formula | C20H25ClN6O3 |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 7-[(2-chlorophenyl)methyl]-3,4,9-trimethyl-1-(2-oxopropyl)-5a,9a,10,10a-tetrahydro-4H-purino[8,7-c][1,2,4]triazine-6,8-dione |
| SMILES | CC(=O)CN1N=C(C)C(C)N2C3C(=O)N(Cc4ccccc4Cl)C(=O)N(C)C3NC12 |
| InChI | InChI=1S/C20H25ClN6O3/c1-11(28)9-26-19-22-17-16(27(19)13(3)12(2)23-26)18(29)25(20(30)24(17)4)10-14-7-5-6-8-15(14)21/h5-8,13,16-17,19,22H,9-10H2,1-4H3 |
| InChIKey | MFWGNWIGHNIXIB-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 88.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |