C21H27N5O4 — CID 73280894
6-(2,4-dimethoxyphenyl)-4,7,8-trimethyl-2-propyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione (PubChem CID 73280894) has the molecular formula C21H27N5O4 and a molecular weight of 413.48 g/mol. Its IUPAC name is 6-(2,4-dimethoxyphenyl)-4,7,8-trimethyl-2-propyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 6-(2,4-dimethoxyphenyl)-4,7,8-trimethyl-2-propyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 73280894 |
| Molecular Formula | C21H27N5O4 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 6-(2,4-dimethoxyphenyl)-4,7,8-trimethyl-2-propyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione |
| SMILES | CCCN1C(=O)C2C(N=C3N(c4ccc(OC)cc4OC)C(C)=C(C)N32)N(C)C1=O |
| InChI | InChI=1S/C21H27N5O4/c1-7-10-24-19(27)17-18(23(4)21(24)28)22-20-25(12(2)13(3)26(17)20)15-9-8-14(29-5)11-16(15)30-6/h8-9,11,17-18H,7,10H2,1-6H3 |
| InChIKey | NNBNROVTMJUUTR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 77.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |