C20H25N5O3 — CID 73281636
8-(cyclohexylamino)-3-methyl-7-phenacyl-4,5-dihydropurine-2,6-dione (PubChem CID 73281636) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is 8-(cyclohexylamino)-3-methyl-7-phenacyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 8-(cyclohexylamino)-3-methyl-7-phenacyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 73281636 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 8-(cyclohexylamino)-3-methyl-7-phenacyl-4,5-dihydropurine-2,6-dione |
| SMILES | CN1C(=O)NC(=O)C2C1N=C(NC1CCCCC1)N2CC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H25N5O3/c1-24-17-16(18(27)23-20(24)28)25(12-15(26)13-8-4-2-5-9-13)19(22-17)21-14-10-6-3-7-11-14/h2,4-5,8-9,14,16-17H,3,6-7,10-12H2,1H3,(H,21,22)(H,23,27,28) |
| InChIKey | RGHSBIPRGBBMQK-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |