C17H17FN7O3+ — CID 73284307
2-[3-(4-fluorophenyl)-7,9-dimethyl-6,8-dioxo-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-1-yl]acetamide (PubChem CID 73284307) has the molecular formula C17H17FN7O3+ and a molecular weight of 386.37 g/mol. Its IUPAC name is 2-[3-(4-fluorophenyl)-7,9-dimethyl-6,8-dioxo-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-1-yl]acetamide.
| Compound Name | 2-[3-(4-fluorophenyl)-7,9-dimethyl-6,8-dioxo-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 73284307 |
| Molecular Formula | C17H17FN7O3+ |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 2-[3-(4-fluorophenyl)-7,9-dimethyl-6,8-dioxo-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-1-yl]acetamide |
| SMILES | CN1C(=O)C2C(=NC3=[N+]2CC(c2ccc(F)cc2)=NN3CC(N)=O)N(C)C1=O |
| InChI | InChI=1S/C17H16FN7O3/c1-22-14-13(15(27)23(2)17(22)28)24-7-11(9-3-5-10(18)6-4-9)21-25(8-12(19)26)16(24)20-14/h3-6,13H,7-8H2,1-2H3,(H-,19,26)/p+1 |
| InChIKey | GRJGDOWNEHYREJ-UHFFFAOYSA-O |
| XLogP | -1.00 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|