C21H19ClF2N4O3S — CID 73291738
N-[3-[(6-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)methoxy]-2,6-difluorobenzoyl]-1-methylpiperidine-4-carboxamide (PubChem CID 73291738) has the molecular formula C21H19ClF2N4O3S and a molecular weight of 480.92 g/mol. Its IUPAC name is N-[3-[(6-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)methoxy]-2,6-difluorobenzoyl]-1-methylpiperidine-4-carboxamide.
| Compound Name | N-[3-[(6-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)methoxy]-2,6-difluorobenzoyl]-1-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 73291738 |
| Molecular Formula | C21H19ClF2N4O3S |
| Molecular Weight | 480.92 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | N-[3-[(6-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)methoxy]-2,6-difluorobenzoyl]-1-methylpiperidine-4-carboxamide |
| SMILES | CN1CCC(C(=O)NC(=O)c2c(F)ccc(OCc3nc4cc(Cl)cnc4s3)c2F)CC1 |
| InChI | InChI=1S/C21H19ClF2N4O3S/c1-28-6-4-11(5-7-28)19(29)27-20(30)17-13(23)2-3-15(18(17)24)31-10-16-26-14-8-12(22)9-25-21(14)32-16/h2-3,8-9,11H,4-7,10H2,1H3,(H,27,29,30) |
| InChIKey | WHLAOILNESDSJJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.92 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|