C17H10ClFN4S — CID 73292453
4-(2-chloro-6-fluoroquinolin-3-yl)-6-thiophen-2-ylpyrimidin-2-amine (PubChem CID 73292453) has the molecular formula C17H10ClFN4S and a molecular weight of 356.81 g/mol. Its IUPAC name is 4-(2-chloro-6-fluoroquinolin-3-yl)-6-thiophen-2-ylpyrimidin-2-amine.
| Compound Name | 4-(2-chloro-6-fluoroquinolin-3-yl)-6-thiophen-2-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 73292453 |
| Molecular Formula | C17H10ClFN4S |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | 4-(2-chloro-6-fluoroquinolin-3-yl)-6-thiophen-2-ylpyrimidin-2-amine |
| SMILES | Nc1nc(-c2cccs2)cc(-c2cc3cc(F)ccc3nc2Cl)n1 |
| InChI | InChI=1S/C17H10ClFN4S/c18-16-11(7-9-6-10(19)3-4-12(9)21-16)13-8-14(23-17(20)22-13)15-2-1-5-24-15/h1-8H,(H2,20,22,23) |
| InChIKey | BQENKGNCKYUXNM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|