C14H11F6NO5 — CID 73292480
methyl 5-(3-nitrophenyl)-5-oxo-2,2-bis(trifluoromethyl)pentanoate (PubChem CID 73292480) has the molecular formula C14H11F6NO5 and a molecular weight of 387.23 g/mol. Its IUPAC name is methyl 5-(3-nitrophenyl)-5-oxo-2,2-bis(trifluoromethyl)pentanoate.
| Compound Name | methyl 5-(3-nitrophenyl)-5-oxo-2,2-bis(trifluoromethyl)pentanoate |
|---|---|
| PubChem CID | 73292480 |
| Molecular Formula | C14H11F6NO5 |
| Molecular Weight | 387.23 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | methyl 5-(3-nitrophenyl)-5-oxo-2,2-bis(trifluoromethyl)pentanoate |
| SMILES | COC(=O)C(CCC(=O)c1cccc([N+](=O)[O-])c1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H11F6NO5/c1-26-11(23)12(13(15,16)17,14(18,19)20)6-5-10(22)8-3-2-4-9(7-8)21(24)25/h2-4,7H,5-6H2,1H3 |
| InChIKey | NGVQNSOEYWZTFQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.23 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|