About CID 73292792
CID 73292792 (PubChem CID 73292792) has the molecular formula C44H48N4O2
and a molecular weight of 664.89 g/mol.
Molecular Properties
| Compound Name | CID 73292792 |
| PubChem CID | 73292792 |
| Molecular Formula | C44H48N4O2 |
| Molecular Weight | 664.89 g/mol |
| Exact Mass | 664.38 |
| IUPAC Name | — |
| SMILES | CC1(c2ccc(O)cc2)c2ccc([nH]2)C2(CCCCC2)c2ccc([nH]2)C(C)(c2ccc(O)cc2)c2ccc([nH]2)C2(CCCCC2)c2ccc1[nH]2 |
| InChI | InChI=1S/C44H48N4O2/c1-41(29-9-13-31(49)14-10-29)33-17-21-37(45-33)43(25-5-3-6-26-43)39-23-19-35(47-39)42(2,30-11-15-32(50)16-12-30)36-20-24-40(48-36)44(27-7-4-8-28-44)38-22-18-34(41)46-38/h9-24,45-50H,3-8,25-28H2,1-2H3 |
| InChIKey | HPPDMUFPRUBIKY-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 103.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 664.89 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 73292792 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 73292792?
The IUPAC name of CID 73292792 (CID 73292792) is not available.
What is the SMILES notation for CID 73292792?
The canonical SMILES for CID 73292792 is CC1(c2ccc(O)cc2)c2ccc([nH]2)C2(CCCCC2)c2ccc([nH]2)C(C)(c2ccc(O)cc2)c2ccc([nH]2)C2(CCCCC2)c2ccc1[nH]2.
What is the InChIKey of CID 73292792?
The InChIKey is HPPDMUFPRUBIKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C44H48N4O2/c1-41(29-9-13-31(49)14-10-29)33-17-21-37(45-33)43(25-5-3-6-26-43)39-23-19-35(47-39)42(2,30-11-15-32(50)16-12-30)36-20-24-40(48-36)44(27-7-4-8-28-44)38-22-18-34(41)46-38/h9-24,45-50H,3-8,25-28H2,1-2H3.
What are the key properties of CID 73292792?
CID 73292792 has a molecular weight of 664.89 g/mol, XLogP of 9.93, 2 rotatable bonds, 6 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 73292792 is sourced from PubChem (CID 73292792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).