C37H28IN7O7S2 — CID 73293193
5-[4-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]butylcarbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 73293193) has the molecular formula C37H28IN7O7S2 and a molecular weight of 873.71 g/mol. Its IUPAC name is 5-[4-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]butylcarbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 5-[4-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]butylcarbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 73293193 |
| Molecular Formula | C37H28IN7O7S2 |
| Molecular Weight | 873.71 g/mol |
| Exact Mass | 873.05 |
| IUPAC Name | 5-[4-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]butylcarbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | Nc1ncnc2c1nc(Sc1cc3c(cc1I)OCO3)n2CCCCNC(=S)Nc1ccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c(C(=O)O)c1 |
| InChI | InChI=1S/C37H28IN7O7S2/c38-25-14-28-29(51-17-50-28)15-30(25)54-37-44-32-33(39)41-16-42-34(32)45(37)10-2-1-9-40-36(53)43-18-3-6-21(24(11-18)35(48)49)31-22-7-4-19(46)12-26(22)52-27-13-20(47)5-8-23(27)31/h3-8,11-16,46H,1-2,9-10,17H2,(H,48,49)(H2,39,41,42)(H2,40,43,53) |
| InChIKey | PCQJLTSXPRSTRL-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 199.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.71 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|