C41H36IN7O7S2 — CID 73293195
5-[8-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]octylcarbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 73293195) has the molecular formula C41H36IN7O7S2 and a molecular weight of 929.82 g/mol. Its IUPAC name is 5-[8-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]octylcarbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 5-[8-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]octylcarbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 73293195 |
| Molecular Formula | C41H36IN7O7S2 |
| Molecular Weight | 929.82 g/mol |
| Exact Mass | 929.12 |
| IUPAC Name | 5-[8-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]octylcarbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | Nc1ncnc2c1nc(Sc1cc3c(cc1I)OCO3)n2CCCCCCCCNC(=S)Nc1ccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c(C(=O)O)c1 |
| InChI | InChI=1S/C41H36IN7O7S2/c42-29-18-32-33(55-21-54-32)19-34(29)58-41-48-36-37(43)45-20-46-38(36)49(41)14-6-4-2-1-3-5-13-44-40(57)47-22-7-10-25(28(15-22)39(52)53)35-26-11-8-23(50)16-30(26)56-31-17-24(51)9-12-27(31)35/h7-12,15-20,50H,1-6,13-14,21H2,(H,52,53)(H2,43,45,46)(H2,44,47,57) |
| InChIKey | LZYKCQZQQWLMKM-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 199.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 929.82 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|