C22H44O4Si2 — CID 73293402
tert-butyl-[(1R,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-ethenyl-2-(methoxymethoxy)hex-5-ynoxy]-dimethylsilane (PubChem CID 73293402) has the molecular formula C22H44O4Si2 and a molecular weight of 428.76 g/mol. Its IUPAC name is tert-butyl-[(1R,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-ethenyl-2-(methoxymethoxy)hex-5-ynoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1R,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-ethenyl-2-(methoxymethoxy)hex-5-ynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 73293402 |
| Molecular Formula | C22H44O4Si2 |
| Molecular Weight | 428.76 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | tert-butyl-[(1R,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-ethenyl-2-(methoxymethoxy)hex-5-ynoxy]-dimethylsilane |
| SMILES | C#CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](OCOC)[C@@H](C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H44O4Si2/c1-14-16-19(26-28(12,13)22(6,7)8)20(24-17-23-9)18(15-2)25-27(10,11)21(3,4)5/h1,15,18-20H,2,16-17H2,3-13H3/t18-,19-,20-/m1/s1 |
| InChIKey | HCYKRFCESQHWCM-VAMGGRTRSA-N |
| XLogP | 5.97 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.76 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|