C22H16ClF3N2O3 — CID 73293602
4-[1-[2-chloro-6-(trifluoromethyl)benzoyl]indazol-3-yl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 73293602) has the molecular formula C22H16ClF3N2O3 and a molecular weight of 448.83 g/mol. Its IUPAC name is 4-[1-[2-chloro-6-(trifluoromethyl)benzoyl]indazol-3-yl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 4-[1-[2-chloro-6-(trifluoromethyl)benzoyl]indazol-3-yl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 73293602 |
| Molecular Formula | C22H16ClF3N2O3 |
| Molecular Weight | 448.83 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 4-[1-[2-chloro-6-(trifluoromethyl)benzoyl]indazol-3-yl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)C1CC=C(c2nn(C(=O)c3c(Cl)cccc3C(F)(F)F)c3ccccc23)CC1 |
| InChI | InChI=1S/C22H16ClF3N2O3/c23-16-6-3-5-15(22(24,25)26)18(16)20(29)28-17-7-2-1-4-14(17)19(27-28)12-8-10-13(11-9-12)21(30)31/h1-8,13H,9-11H2,(H,30,31) |
| InChIKey | WAZYMFVBHLCPOF-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.83 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |