About (4-aminofuro[2,3-c]quinolin-2-yl)methanol
(4-aminofuro[2,3-c]quinolin-2-yl)methanol (PubChem CID 73293922) has the molecular formula C12H10N2O2
and a molecular weight of 214.22 g/mol. Its IUPAC name is (4-aminofuro[2,3-c]quinolin-2-yl)methanol.
Molecular Properties
| Compound Name | (4-aminofuro[2,3-c]quinolin-2-yl)methanol |
| PubChem CID | 73293922 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | (4-aminofuro[2,3-c]quinolin-2-yl)methanol |
| SMILES | Nc1nc2ccccc2c2cc(CO)oc12 |
| InChI | InChI=1S/C12H10N2O2/c13-12-11-9(5-7(6-15)16-11)8-3-1-2-4-10(8)14-12/h1-5,15H,6H2,(H2,13,14) |
| InChIKey | ZYZYENTWKQQOTC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-aminofuro[2,3-c]quinolin-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-aminofuro[2,3-c]quinolin-2-yl)methanol?
The IUPAC name of (4-aminofuro[2,3-c]quinolin-2-yl)methanol (CID 73293922) is (4-aminofuro[2,3-c]quinolin-2-yl)methanol.
What is the SMILES notation for (4-aminofuro[2,3-c]quinolin-2-yl)methanol?
The canonical SMILES for (4-aminofuro[2,3-c]quinolin-2-yl)methanol is Nc1nc2ccccc2c2cc(CO)oc12.
What is the InChIKey of (4-aminofuro[2,3-c]quinolin-2-yl)methanol?
The InChIKey is ZYZYENTWKQQOTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O2/c13-12-11-9(5-7(6-15)16-11)8-3-1-2-4-10(8)14-12/h1-5,15H,6H2,(H2,13,14).
What are the key properties of (4-aminofuro[2,3-c]quinolin-2-yl)methanol?
(4-aminofuro[2,3-c]quinolin-2-yl)methanol has a molecular weight of 214.22 g/mol, XLogP of 2.06, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-aminofuro[2,3-c]quinolin-2-yl)methanol is sourced from PubChem (CID 73293922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).