C22H26N4O — CID 73293991
6-[6-(2,2,6,6-tetramethylpiperidin-4-yl)oxypyridazin-3-yl]isoquinoline (PubChem CID 73293991) has the molecular formula C22H26N4O and a molecular weight of 362.48 g/mol. Its IUPAC name is 6-[6-(2,2,6,6-tetramethylpiperidin-4-yl)oxypyridazin-3-yl]isoquinoline.
| Compound Name | 6-[6-(2,2,6,6-tetramethylpiperidin-4-yl)oxypyridazin-3-yl]isoquinoline |
|---|---|
| PubChem CID | 73293991 |
| Molecular Formula | C22H26N4O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 6-[6-(2,2,6,6-tetramethylpiperidin-4-yl)oxypyridazin-3-yl]isoquinoline |
| SMILES | CC1(C)CC(Oc2ccc(-c3ccc4cnccc4c3)nn2)CC(C)(C)N1 |
| InChI | InChI=1S/C22H26N4O/c1-21(2)12-18(13-22(3,4)26-21)27-20-8-7-19(24-25-20)16-5-6-17-14-23-10-9-15(17)11-16/h5-11,14,18,26H,12-13H2,1-4H3 |
| InChIKey | AEOSGEZAMPZXCG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |