C30H52O4 — CID 73294107
trans-(1R,3Z,5R)-3-[(2E)-2-[(1R,3aS,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-5-(4-hydroxybutoxy)cyclohexan-1-ol (PubChem CID 73294107) has the molecular formula C30H52O4 and a molecular weight of 476.74 g/mol. Its IUPAC name is trans-(1R,3Z,5R)-3-[(2E)-2-[(1R,3aS,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-5-(4-hydroxybutoxy)cyclohexan-1-ol.
| Compound Name | trans-(1R,3Z,5R)-3-[(2E)-2-[(1R,3aS,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-5-(4-hydroxybutoxy)cyclohexan-1-ol |
|---|---|
| PubChem CID | 73294107 |
| Molecular Formula | C30H52O4 |
| Molecular Weight | 476.74 g/mol |
| Exact Mass | 476.39 |
| IUPAC Name | trans-(1R,3Z,5R)-3-[(2E)-2-[(1R,3aS,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-5-(4-hydroxybutoxy)cyclohexan-1-ol |
| SMILES | C[C@H](CCCC(C)(C)O)[C@H]1CC[C@H]2/C(=C/C=C3/C[C@@H](O)C[C@H](OCCCCO)C3)CCC[C@]12C |
| InChI | InChI=1S/C30H52O4/c1-22(9-7-15-29(2,3)33)27-13-14-28-24(10-8-16-30(27,28)4)12-11-23-19-25(32)21-26(20-23)34-18-6-5-17-31/h11-12,22,25-28,31-33H,5-10,13-21H2,1-4H3/b23-11-,24-12+/t22-,25-,26-,27-,28+,30-/m1/s1 |
| InChIKey | XUSLLPSBKBOGOG-JYTOJRSNSA-N |
| XLogP | 6.34 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.74 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|