C17H17NO4 — CID 73294383
8-methoxy-13,15-dimethyl-13-azadispiro[5.0.57.36]pentadeca-1,4,8,11-tetraene-3,10,14-trione (PubChem CID 73294383) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is 8-methoxy-13,15-dimethyl-13-azadispiro[5.0.57.36]pentadeca-1,4,8,11-tetraene-3,10,14-trione.
| Compound Name | 8-methoxy-13,15-dimethyl-13-azadispiro[5.0.57.36]pentadeca-1,4,8,11-tetraene-3,10,14-trione |
|---|---|
| PubChem CID | 73294383 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 8-methoxy-13,15-dimethyl-13-azadispiro[5.0.57.36]pentadeca-1,4,8,11-tetraene-3,10,14-trione |
| SMILES | COC1=CC(=O)C=CC12N(C)C(=O)C(C)C21C=CC(=O)C=C1 |
| InChI | InChI=1S/C17H17NO4/c1-11-15(21)18(2)17(9-6-13(20)10-14(17)22-3)16(11)7-4-12(19)5-8-16/h4-11H,1-3H3 |
| InChIKey | DVHXNAWTULVVEQ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |