About 3-phenylpropyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate
3-phenylpropyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate (PubChem CID 73294496) has the molecular formula C14H17NO4
and a molecular weight of 263.29 g/mol. Its IUPAC name is 3-phenylpropyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate.
Molecular Properties
| Compound Name | 3-phenylpropyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate |
| PubChem CID | 73294496 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 3-phenylpropyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate |
| SMILES | C[C@@H]1OC(=O)[C@@H]1NC(=O)OCCCc1ccccc1 |
| InChI | InChI=1S/C14H17NO4/c1-10-12(13(16)19-10)15-14(17)18-9-5-8-11-6-3-2-4-7-11/h2-4,6-7,10,12H,5,8-9H2,1H3,(H,15,17)/t10-,12+/m0/s1 |
| InChIKey | XVBTUXCSJHRZJS-CMPLNLGQSA-N |
| XLogP | 1.66 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylpropyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylpropyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate?
The IUPAC name of 3-phenylpropyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate (CID 73294496) is 3-phenylpropyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate.
What is the SMILES notation for 3-phenylpropyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate?
The canonical SMILES for 3-phenylpropyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate is C[C@@H]1OC(=O)[C@@H]1NC(=O)OCCCc1ccccc1.
What is the InChIKey of 3-phenylpropyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate?
The InChIKey is XVBTUXCSJHRZJS-CMPLNLGQSA-N. The full InChI is InChI=1S/C14H17NO4/c1-10-12(13(16)19-10)15-14(17)18-9-5-8-11-6-3-2-4-7-11/h2-4,6-7,10,12H,5,8-9H2,1H3,(H,15,17)/t10-,12+/m0/s1.
What are the key properties of 3-phenylpropyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate?
3-phenylpropyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate has a molecular weight of 263.29 g/mol, XLogP of 1.66, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylpropyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate is sourced from PubChem (CID 73294496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).