About pentyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate
pentyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate (PubChem CID 73294499) has the molecular formula C10H17NO4
and a molecular weight of 215.25 g/mol. Its IUPAC name is pentyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate.
Molecular Properties
| Compound Name | pentyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate |
| PubChem CID | 73294499 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | pentyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate |
| SMILES | CCCCCOC(=O)N[C@H]1C(=O)O[C@H]1C |
| InChI | InChI=1S/C10H17NO4/c1-3-4-5-6-14-10(13)11-8-7(2)15-9(8)12/h7-8H,3-6H2,1-2H3,(H,11,13)/t7-,8+/m0/s1 |
| InChIKey | HZDBYMSLJOAPIN-JGVFFNPUSA-N |
| XLogP | 1.22 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|
Analyze pentyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate?
The IUPAC name of pentyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate (CID 73294499) is pentyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate.
What is the SMILES notation for pentyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate?
The canonical SMILES for pentyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate is CCCCCOC(=O)N[C@H]1C(=O)O[C@H]1C.
What is the InChIKey of pentyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate?
The InChIKey is HZDBYMSLJOAPIN-JGVFFNPUSA-N. The full InChI is InChI=1S/C10H17NO4/c1-3-4-5-6-14-10(13)11-8-7(2)15-9(8)12/h7-8H,3-6H2,1-2H3,(H,11,13)/t7-,8+/m0/s1.
What are the key properties of pentyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate?
pentyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate has a molecular weight of 215.25 g/mol, XLogP of 1.22, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pentyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate is sourced from PubChem (CID 73294499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).