C25H26F4N2O — CID 73294834
(2R,5S,7S)-2-ethyl-14-(4-fluorophenyl)-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraen-5-ol (PubChem CID 73294834) has the molecular formula C25H26F4N2O and a molecular weight of 446.49 g/mol. Its IUPAC name is (2R,5S,7S)-2-ethyl-14-(4-fluorophenyl)-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraen-5-ol.
| Compound Name | (2R,5S,7S)-2-ethyl-14-(4-fluorophenyl)-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraen-5-ol |
|---|---|
| PubChem CID | 73294834 |
| Molecular Formula | C25H26F4N2O |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | (2R,5S,7S)-2-ethyl-14-(4-fluorophenyl)-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraen-5-ol |
| SMILES | CC[C@@]12CC[C@@](O)(C(F)(F)F)C[C@@H]1CCCc1cc3c(cnn3-c3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C25H26F4N2O/c1-2-23-10-11-24(32,25(27,28)29)14-18(23)5-3-4-16-13-22-17(12-21(16)23)15-30-31(22)20-8-6-19(26)7-9-20/h6-9,12-13,15,18,32H,2-5,10-11,14H2,1H3/t18-,23+,24-/m0/s1 |
| InChIKey | NUUZDHVBYHSFNG-GLYQVZKVSA-N |
| XLogP | 6.24 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |