C18H11F4N3O2 — CID 73294969
3-fluoro-5-[3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]benzoic acid (PubChem CID 73294969) has the molecular formula C18H11F4N3O2 and a molecular weight of 377.30 g/mol. Its IUPAC name is 3-fluoro-5-[3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]benzoic acid.
| Compound Name | 3-fluoro-5-[3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]benzoic acid |
|---|---|
| PubChem CID | 73294969 |
| Molecular Formula | C18H11F4N3O2 |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 3-fluoro-5-[3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]benzoic acid |
| SMILES | O=C(O)c1cc(F)cc(-c2cccc(Nc3nccc(C(F)(F)F)n3)c2)c1 |
| InChI | InChI=1S/C18H11F4N3O2/c19-13-7-11(6-12(8-13)16(26)27)10-2-1-3-14(9-10)24-17-23-5-4-15(25-17)18(20,21)22/h1-9H,(H,26,27)(H,23,24,25) |
| InChIKey | HGSQMMSBTUAJDB-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |