C12H13N3O3 — CID 73295702
2-(3-phenylpropyl)-1,2,4-triazinane-3,5,6-trione (PubChem CID 73295702) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is 2-(3-phenylpropyl)-1,2,4-triazinane-3,5,6-trione.
| Compound Name | 2-(3-phenylpropyl)-1,2,4-triazinane-3,5,6-trione |
|---|---|
| PubChem CID | 73295702 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 2-(3-phenylpropyl)-1,2,4-triazinane-3,5,6-trione |
| SMILES | O=c1[nH]c(=O)n(CCCc2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C12H13N3O3/c16-10-11(17)14-15(12(18)13-10)8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H,14,17)(H,13,16,18) |
| InChIKey | AFZTWLMBURQCEB-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|