About 4-[1-(2-chloro-6-cyclopropylbenzoyl)pyrazolo[4,3-b]pyridin-3-yl]-3,5-difluorobenzoic acid
4-[1-(2-chloro-6-cyclopropylbenzoyl)pyrazolo[4,3-b]pyridin-3-yl]-3,5-difluorobenzoic acid (PubChem CID 73295937) has the molecular formula C23H14ClF2N3O3
and a molecular weight of 453.83 g/mol. Its IUPAC name is 4-[1-(2-chloro-6-cyclopropylbenzoyl)pyrazolo[4,3-b]pyridin-3-yl]-3,5-difluorobenzoic acid.
Molecular Properties
| Compound Name | 4-[1-(2-chloro-6-cyclopropylbenzoyl)pyrazolo[4,3-b]pyridin-3-yl]-3,5-difluorobenzoic acid |
| PubChem CID | 73295937 |
| Molecular Formula | C23H14ClF2N3O3 |
| Molecular Weight | 453.83 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | 4-[1-(2-chloro-6-cyclopropylbenzoyl)pyrazolo[4,3-b]pyridin-3-yl]-3,5-difluorobenzoic acid |
| SMILES | O=C(O)c1cc(F)c(-c2nn(C(=O)c3c(Cl)cccc3C3CC3)c3cccnc23)c(F)c1 |
| InChI | InChI=1S/C23H14ClF2N3O3/c24-14-4-1-3-13(11-6-7-11)18(14)22(30)29-17-5-2-8-27-20(17)21(28-29)19-15(25)9-12(23(31)32)10-16(19)26/h1-5,8-11H,6-7H2,(H,31,32) |
| InChIKey | AMQKIZZEIKBRFO-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.83 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[1-(2-chloro-6-cyclopropylbenzoyl)pyrazolo[4,3-b]pyridin-3-yl]-3,5-difluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(2-chloro-6-cyclopropylbenzoyl)pyrazolo[4,3-b]pyridin-3-yl]-3,5-difluorobenzoic acid?
The IUPAC name of 4-[1-(2-chloro-6-cyclopropylbenzoyl)pyrazolo[4,3-b]pyridin-3-yl]-3,5-difluorobenzoic acid (CID 73295937) is 4-[1-(2-chloro-6-cyclopropylbenzoyl)pyrazolo[4,3-b]pyridin-3-yl]-3,5-difluorobenzoic acid.
What is the SMILES notation for 4-[1-(2-chloro-6-cyclopropylbenzoyl)pyrazolo[4,3-b]pyridin-3-yl]-3,5-difluorobenzoic acid?
The canonical SMILES for 4-[1-(2-chloro-6-cyclopropylbenzoyl)pyrazolo[4,3-b]pyridin-3-yl]-3,5-difluorobenzoic acid is O=C(O)c1cc(F)c(-c2nn(C(=O)c3c(Cl)cccc3C3CC3)c3cccnc23)c(F)c1.
What is the InChIKey of 4-[1-(2-chloro-6-cyclopropylbenzoyl)pyrazolo[4,3-b]pyridin-3-yl]-3,5-difluorobenzoic acid?
The InChIKey is AMQKIZZEIKBRFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H14ClF2N3O3/c24-14-4-1-3-13(11-6-7-11)18(14)22(30)29-17-5-2-8-27-20(17)21(28-29)19-15(25)9-12(23(31)32)10-16(19)26/h1-5,8-11H,6-7H2,(H,31,32).
What are the key properties of 4-[1-(2-chloro-6-cyclopropylbenzoyl)pyrazolo[4,3-b]pyridin-3-yl]-3,5-difluorobenzoic acid?
4-[1-(2-chloro-6-cyclopropylbenzoyl)pyrazolo[4,3-b]pyridin-3-yl]-3,5-difluorobenzoic acid has a molecular weight of 453.83 g/mol, XLogP of 5.29, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(2-chloro-6-cyclopropylbenzoyl)pyrazolo[4,3-b]pyridin-3-yl]-3,5-difluorobenzoic acid is sourced from PubChem (CID 73295937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).