C23H24F3N3O — CID 73295984
2-pyridin-3-yl-1-[7-(trifluoromethyl)-1,2,3,5,11,11a-hexahydroindolizino[7,6-b]indol-10-yl]propan-2-ol (PubChem CID 73295984) has the molecular formula C23H24F3N3O and a molecular weight of 415.46 g/mol. Its IUPAC name is 2-pyridin-3-yl-1-[7-(trifluoromethyl)-1,2,3,5,11,11a-hexahydroindolizino[7,6-b]indol-10-yl]propan-2-ol.
| Compound Name | 2-pyridin-3-yl-1-[7-(trifluoromethyl)-1,2,3,5,11,11a-hexahydroindolizino[7,6-b]indol-10-yl]propan-2-ol |
|---|---|
| PubChem CID | 73295984 |
| Molecular Formula | C23H24F3N3O |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 2-pyridin-3-yl-1-[7-(trifluoromethyl)-1,2,3,5,11,11a-hexahydroindolizino[7,6-b]indol-10-yl]propan-2-ol |
| SMILES | CC(O)(Cn1c2c(c3cc(C(F)(F)F)ccc31)CN1CCCC1C2)c1cccnc1 |
| InChI | InChI=1S/C23H24F3N3O/c1-22(30,16-4-2-8-27-12-16)14-29-20-7-6-15(23(24,25)26)10-18(20)19-13-28-9-3-5-17(28)11-21(19)29/h2,4,6-8,10,12,17,30H,3,5,9,11,13-14H2,1H3 |
| InChIKey | WVUWMNMBJGQRRG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|