C24H18N2O7S — CID 73296091
2-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butyl]-1,1,3-trioxo-1,2-benzothiazole-6-carboxylic acid (PubChem CID 73296091) has the molecular formula C24H18N2O7S and a molecular weight of 478.48 g/mol. Its IUPAC name is 2-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butyl]-1,1,3-trioxo-1,2-benzothiazole-6-carboxylic acid.
| Compound Name | 2-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butyl]-1,1,3-trioxo-1,2-benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 73296091 |
| Molecular Formula | C24H18N2O7S |
| Molecular Weight | 478.48 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | 2-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butyl]-1,1,3-trioxo-1,2-benzothiazole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)S(=O)(=O)N(CCCCN1C(=O)c3cccc4cccc(c34)C1=O)C2=O |
| InChI | InChI=1S/C24H18N2O7S/c27-21-17-7-3-5-14-6-4-8-18(20(14)17)22(28)25(21)11-1-2-12-26-23(29)16-10-9-15(24(30)31)13-19(16)34(26,32)33/h3-10,13H,1-2,11-12H2,(H,30,31) |
| InChIKey | GTDWBWPQKMNPCR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 129.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|