About 2-[5-(1,3-dioxobenzo[de]isoquinolin-2-yl)pentylsulfamoyl]benzoic acid
2-[5-(1,3-dioxobenzo[de]isoquinolin-2-yl)pentylsulfamoyl]benzoic acid (PubChem CID 73296094) has the molecular formula C24H22N2O6S
and a molecular weight of 466.52 g/mol. Its IUPAC name is 2-[5-(1,3-dioxobenzo[de]isoquinolin-2-yl)pentylsulfamoyl]benzoic acid.
Molecular Properties
| Compound Name | 2-[5-(1,3-dioxobenzo[de]isoquinolin-2-yl)pentylsulfamoyl]benzoic acid |
| PubChem CID | 73296094 |
| Molecular Formula | C24H22N2O6S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | 2-[5-(1,3-dioxobenzo[de]isoquinolin-2-yl)pentylsulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1S(=O)(=O)NCCCCCN1C(=O)c2cccc3cccc(c23)C1=O |
| InChI | InChI=1S/C24H22N2O6S/c27-22-18-11-6-8-16-9-7-12-19(21(16)18)23(28)26(22)15-5-1-4-14-25-33(31,32)20-13-3-2-10-17(20)24(29)30/h2-3,6-13,25H,1,4-5,14-15H2,(H,29,30) |
| InChIKey | NAPRNXJZZCBCEH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-(1,3-dioxobenzo[de]isoquinolin-2-yl)pentylsulfamoyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(1,3-dioxobenzo[de]isoquinolin-2-yl)pentylsulfamoyl]benzoic acid?
The IUPAC name of 2-[5-(1,3-dioxobenzo[de]isoquinolin-2-yl)pentylsulfamoyl]benzoic acid (CID 73296094) is 2-[5-(1,3-dioxobenzo[de]isoquinolin-2-yl)pentylsulfamoyl]benzoic acid.
What is the SMILES notation for 2-[5-(1,3-dioxobenzo[de]isoquinolin-2-yl)pentylsulfamoyl]benzoic acid?
The canonical SMILES for 2-[5-(1,3-dioxobenzo[de]isoquinolin-2-yl)pentylsulfamoyl]benzoic acid is O=C(O)c1ccccc1S(=O)(=O)NCCCCCN1C(=O)c2cccc3cccc(c23)C1=O.
What is the InChIKey of 2-[5-(1,3-dioxobenzo[de]isoquinolin-2-yl)pentylsulfamoyl]benzoic acid?
The InChIKey is NAPRNXJZZCBCEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N2O6S/c27-22-18-11-6-8-16-9-7-12-19(21(16)18)23(28)26(22)15-5-1-4-14-25-33(31,32)20-13-3-2-10-17(20)24(29)30/h2-3,6-13,25H,1,4-5,14-15H2,(H,29,30).
What are the key properties of 2-[5-(1,3-dioxobenzo[de]isoquinolin-2-yl)pentylsulfamoyl]benzoic acid?
2-[5-(1,3-dioxobenzo[de]isoquinolin-2-yl)pentylsulfamoyl]benzoic acid has a molecular weight of 466.52 g/mol, XLogP of 3.28, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(1,3-dioxobenzo[de]isoquinolin-2-yl)pentylsulfamoyl]benzoic acid is sourced from PubChem (CID 73296094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).