C23H26FN3O — CID 73296305
2-(6-fluoro-8,10-dimethyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl)-1-pyridin-4-ylethanol (PubChem CID 73296305) has the molecular formula C23H26FN3O and a molecular weight of 379.48 g/mol. Its IUPAC name is 2-(6-fluoro-8,10-dimethyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl)-1-pyridin-4-ylethanol.
| Compound Name | 2-(6-fluoro-8,10-dimethyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl)-1-pyridin-4-ylethanol |
|---|---|
| PubChem CID | 73296305 |
| Molecular Formula | C23H26FN3O |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 2-(6-fluoro-8,10-dimethyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl)-1-pyridin-4-ylethanol |
| SMILES | Cc1cc(C)c2c(c1)c1c(n2CC(O)c2ccncc2)C(F)CN2CCCC12 |
| InChI | InChI=1S/C23H26FN3O/c1-14-10-15(2)22-17(11-14)21-19-4-3-9-26(19)12-18(24)23(21)27(22)13-20(28)16-5-7-25-8-6-16/h5-8,10-11,18-20,28H,3-4,9,12-13H2,1-2H3 |
| InChIKey | RONXYMKNGFTDIE-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |