C24H27N3O — CID 73296449
2-(10-methylspiro[2,3,5,11c-tetrahydro-1H-indolizino[7,8-b]indole-6,1'-cyclopropane]-7-yl)-1-pyridin-4-ylethanol (PubChem CID 73296449) has the molecular formula C24H27N3O and a molecular weight of 373.50 g/mol. Its IUPAC name is 2-(10-methylspiro[2,3,5,11c-tetrahydro-1H-indolizino[7,8-b]indole-6,1'-cyclopropane]-7-yl)-1-pyridin-4-ylethanol.
| Compound Name | 2-(10-methylspiro[2,3,5,11c-tetrahydro-1H-indolizino[7,8-b]indole-6,1'-cyclopropane]-7-yl)-1-pyridin-4-ylethanol |
|---|---|
| PubChem CID | 73296449 |
| Molecular Formula | C24H27N3O |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | 2-(10-methylspiro[2,3,5,11c-tetrahydro-1H-indolizino[7,8-b]indole-6,1'-cyclopropane]-7-yl)-1-pyridin-4-ylethanol |
| SMILES | Cc1ccc2c(c1)c1c(n2CC(O)c2ccncc2)C2(CC2)CN2CCCC12 |
| InChI | InChI=1S/C24H27N3O/c1-16-4-5-19-18(13-16)22-20-3-2-12-26(20)15-24(8-9-24)23(22)27(19)14-21(28)17-6-10-25-11-7-17/h4-7,10-11,13,20-21,28H,2-3,8-9,12,14-15H2,1H3 |
| InChIKey | YRUAMABBXKICLI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |