C24H29N3O — CID 73296593
1-pyridin-4-yl-2-(6,6,10-trimethyl-2,3,5,11c-tetrahydro-1H-indolizino[7,8-b]indol-7-yl)ethanol (PubChem CID 73296593) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is 1-pyridin-4-yl-2-(6,6,10-trimethyl-2,3,5,11c-tetrahydro-1H-indolizino[7,8-b]indol-7-yl)ethanol.
| Compound Name | 1-pyridin-4-yl-2-(6,6,10-trimethyl-2,3,5,11c-tetrahydro-1H-indolizino[7,8-b]indol-7-yl)ethanol |
|---|---|
| PubChem CID | 73296593 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 1-pyridin-4-yl-2-(6,6,10-trimethyl-2,3,5,11c-tetrahydro-1H-indolizino[7,8-b]indol-7-yl)ethanol |
| SMILES | Cc1ccc2c(c1)c1c(n2CC(O)c2ccncc2)C(C)(C)CN2CCCC12 |
| InChI | InChI=1S/C24H29N3O/c1-16-6-7-19-18(13-16)22-20-5-4-12-26(20)15-24(2,3)23(22)27(19)14-21(28)17-8-10-25-11-9-17/h6-11,13,20-21,28H,4-5,12,14-15H2,1-3H3 |
| InChIKey | LGGXEXLPKKMGQR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |