C23H26N4O2 — CID 73296595
5-[1-hydroxy-2-(10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl)ethyl]pyridine-2-carboxamide (PubChem CID 73296595) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 5-[1-hydroxy-2-(10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl)ethyl]pyridine-2-carboxamide.
| Compound Name | 5-[1-hydroxy-2-(10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 73296595 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 5-[1-hydroxy-2-(10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl)ethyl]pyridine-2-carboxamide |
| SMILES | Cc1ccc2c(c1)c1c(n2CC(O)c2ccc(C(N)=O)nc2)CCN2CCCC12 |
| InChI | InChI=1S/C23H26N4O2/c1-14-4-7-18-16(11-14)22-19-3-2-9-26(19)10-8-20(22)27(18)13-21(28)15-5-6-17(23(24)29)25-12-15/h4-7,11-12,19,21,28H,2-3,8-10,13H2,1H3,(H2,24,29) |
| InChIKey | IGEDLSZKHSGIOU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|