C23H27N3O2 — CID 73296596
2-(9-methoxy-10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl)-1-pyridin-4-ylethanol (PubChem CID 73296596) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-(9-methoxy-10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl)-1-pyridin-4-ylethanol.
| Compound Name | 2-(9-methoxy-10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl)-1-pyridin-4-ylethanol |
|---|---|
| PubChem CID | 73296596 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 2-(9-methoxy-10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl)-1-pyridin-4-ylethanol |
| SMILES | COc1cc2c(cc1C)c1c(n2CC(O)c2ccncc2)CCN2CCCC12 |
| InChI | InChI=1S/C23H27N3O2/c1-15-12-17-20(13-22(15)28-2)26(14-21(27)16-5-8-24-9-6-16)19-7-11-25-10-3-4-18(25)23(17)19/h5-6,8-9,12-13,18,21,27H,3-4,7,10-11,14H2,1-2H3 |
| InChIKey | DOHAXXNIUYSQJQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|