C28H34FN3O — CID 73296597
7-[2-(cyclobutylmethoxy)-2-pyridin-3-ylpropyl]-8-fluoro-10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indole (PubChem CID 73296597) has the molecular formula C28H34FN3O and a molecular weight of 447.60 g/mol. Its IUPAC name is 7-[2-(cyclobutylmethoxy)-2-pyridin-3-ylpropyl]-8-fluoro-10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indole.
| Compound Name | 7-[2-(cyclobutylmethoxy)-2-pyridin-3-ylpropyl]-8-fluoro-10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indole |
|---|---|
| PubChem CID | 73296597 |
| Molecular Formula | C28H34FN3O |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | 7-[2-(cyclobutylmethoxy)-2-pyridin-3-ylpropyl]-8-fluoro-10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indole |
| SMILES | Cc1cc(F)c2c(c1)c1c(n2CC(C)(OCC2CCC2)c2cccnc2)CCN2CCCC12 |
| InChI | InChI=1S/C28H34FN3O/c1-19-14-22-26-24-9-5-12-31(24)13-10-25(26)32(27(22)23(29)15-19)18-28(2,21-8-4-11-30-16-21)33-17-20-6-3-7-20/h4,8,11,14-16,20,24H,3,5-7,9-10,12-13,17-18H2,1-2H3 |
| InChIKey | ABALYWXVCXUXCA-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|