C19H13ClN2O4S — CID 73296810
(2Z)-6-(4-chlorophenyl)-2-[(3,4-dihydroxy-5-methoxyphenyl)methylidene]imidazo[2,1-b][1,3]thiazol-3-one (PubChem CID 73296810) has the molecular formula C19H13ClN2O4S and a molecular weight of 400.84 g/mol. Its IUPAC name is (2Z)-6-(4-chlorophenyl)-2-[(3,4-dihydroxy-5-methoxyphenyl)methylidene]imidazo[2,1-b][1,3]thiazol-3-one.
| Compound Name | (2Z)-6-(4-chlorophenyl)-2-[(3,4-dihydroxy-5-methoxyphenyl)methylidene]imidazo[2,1-b][1,3]thiazol-3-one |
|---|---|
| PubChem CID | 73296810 |
| Molecular Formula | C19H13ClN2O4S |
| Molecular Weight | 400.84 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | (2Z)-6-(4-chlorophenyl)-2-[(3,4-dihydroxy-5-methoxyphenyl)methylidene]imidazo[2,1-b][1,3]thiazol-3-one |
| SMILES | COc1cc(/C=c2\sc3nc(-c4ccc(Cl)cc4)cn3c2=O)cc(O)c1O |
| InChI | InChI=1S/C19H13ClN2O4S/c1-26-15-7-10(6-14(23)17(15)24)8-16-18(25)22-9-13(21-19(22)27-16)11-2-4-12(20)5-3-11/h2-9,23-24H,1H3/b16-8- |
| InChIKey | YWGDYXVZYGVALG-PXNMLYILSA-N |
| XLogP | 3.04 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.84 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|