C25H30N4O2 — CID 73297061
[2-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-1-pyridin-4-ylethyl] pyrrolidine-1-carboxylate (PubChem CID 73297061) has the molecular formula C25H30N4O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is [2-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-1-pyridin-4-ylethyl] pyrrolidine-1-carboxylate.
| Compound Name | [2-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-1-pyridin-4-ylethyl] pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 73297061 |
| Molecular Formula | C25H30N4O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | [2-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-1-pyridin-4-ylethyl] pyrrolidine-1-carboxylate |
| SMILES | Cc1ccc2c(c1)c1c(n2CC(OC(=O)N2CCCC2)c2ccncc2)CCN(C)C1 |
| InChI | InChI=1S/C25H30N4O2/c1-18-5-6-22-20(15-18)21-16-27(2)14-9-23(21)29(22)17-24(19-7-10-26-11-8-19)31-25(30)28-12-3-4-13-28/h5-8,10-11,15,24H,3-4,9,12-14,16-17H2,1-2H3 |
| InChIKey | CEAXBDXVEGRVNX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|