C19H13F4N3O2 — CID 73297229
3-fluoro-5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]benzoic acid (PubChem CID 73297229) has the molecular formula C19H13F4N3O2 and a molecular weight of 391.32 g/mol. Its IUPAC name is 3-fluoro-5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]benzoic acid.
| Compound Name | 3-fluoro-5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]benzoic acid |
|---|---|
| PubChem CID | 73297229 |
| Molecular Formula | C19H13F4N3O2 |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 3-fluoro-5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]benzoic acid |
| SMILES | Cc1cc(Nc2nccc(C(F)(F)F)n2)cc(-c2cc(F)cc(C(=O)O)c2)c1 |
| InChI | InChI=1S/C19H13F4N3O2/c1-10-4-11(12-6-13(17(27)28)8-14(20)7-12)9-15(5-10)25-18-24-3-2-16(26-18)19(21,22)23/h2-9H,1H3,(H,27,28)(H,24,25,26) |
| InChIKey | JXOPOIXRLSJSNL-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |