About (E)-3-(4-hydroxyphenyl)prop-2-enoic acid;pyridine-3-carboxamide
(E)-3-(4-hydroxyphenyl)prop-2-enoic acid;pyridine-3-carboxamide (PubChem CID 73297269) has the molecular formula C15H14N2O4
and a molecular weight of 286.29 g/mol. Its IUPAC name is (E)-3-(4-hydroxyphenyl)prop-2-enoic acid;pyridine-3-carboxamide.
Molecular Properties
| Compound Name | (E)-3-(4-hydroxyphenyl)prop-2-enoic acid;pyridine-3-carboxamide |
| PubChem CID | 73297269 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | (E)-3-(4-hydroxyphenyl)prop-2-enoic acid;pyridine-3-carboxamide |
| SMILES | NC(=O)c1cccnc1.O=C(O)/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C9H8O3.C6H6N2O/c10-8-4-1-7(2-5-8)3-6-9(11)12;7-6(9)5-2-1-3-8-4-5/h1-6,10H,(H,11,12);1-4H,(H2,7,9)/b6-3+; |
| InChIKey | SKXCERIYHDTUMJ-ZIKNSQGESA-N |
| XLogP | 1.67 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(4-hydroxyphenyl)prop-2-enoic acid;pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(4-hydroxyphenyl)prop-2-enoic acid;pyridine-3-carboxamide?
The IUPAC name of (E)-3-(4-hydroxyphenyl)prop-2-enoic acid;pyridine-3-carboxamide (CID 73297269) is (E)-3-(4-hydroxyphenyl)prop-2-enoic acid;pyridine-3-carboxamide.
What is the SMILES notation for (E)-3-(4-hydroxyphenyl)prop-2-enoic acid;pyridine-3-carboxamide?
The canonical SMILES for (E)-3-(4-hydroxyphenyl)prop-2-enoic acid;pyridine-3-carboxamide is NC(=O)c1cccnc1.O=C(O)/C=C/c1ccc(O)cc1.
What is the InChIKey of (E)-3-(4-hydroxyphenyl)prop-2-enoic acid;pyridine-3-carboxamide?
The InChIKey is SKXCERIYHDTUMJ-ZIKNSQGESA-N. The full InChI is InChI=1S/C9H8O3.C6H6N2O/c10-8-4-1-7(2-5-8)3-6-9(11)12;7-6(9)5-2-1-3-8-4-5/h1-6,10H,(H,11,12);1-4H,(H2,7,9)/b6-3+;.
What are the key properties of (E)-3-(4-hydroxyphenyl)prop-2-enoic acid;pyridine-3-carboxamide?
(E)-3-(4-hydroxyphenyl)prop-2-enoic acid;pyridine-3-carboxamide has a molecular weight of 286.29 g/mol, XLogP of 1.67, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(4-hydroxyphenyl)prop-2-enoic acid;pyridine-3-carboxamide is sourced from PubChem (CID 73297269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).