C30H34Cl2FN5O4 — CID 73297272
Milademetan (PubChem CID 73297272) has the molecular formula C30H34Cl2FN5O4 and a molecular weight of 618.54 g/mol.
| Compound Name | Milademetan |
|---|---|
| PubChem CID | 73297272 |
| Molecular Formula | C30H34Cl2FN5O4 |
| Molecular Weight | 618.54 g/mol |
| Exact Mass | 617.20 |
| IUPAC Name | — |
| SMILES | CC1(C)CCC2(CC1)N[C@@H](C(=O)N[C@@H]1CC[C@@H](C(N)=O)OC1)[C@H](c1ccnc(Cl)c1F)[C@]21C(=O)Nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C30H34Cl2FN5O4/c1-28(2)8-10-29(11-9-28)30(18-5-3-15(31)13-19(18)37-27(30)41)21(17-7-12-35-24(32)22(17)33)23(38-29)26(40)36-16-4-6-20(25(34)39)42-14-16/h3,5,7,12-13,16,20-21,23,38H,4,6,8-11,14H2,1-2H3,(H2,34,39)(H,36,40)(H,37,41)/t16-,20+,21+,23-,30-/m1/s1 |
| InChIKey | RYAYYVTWKAOAJF-QISPRATLSA-N |
| XLogP | 3.96 |
| TPSA | 135.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|