C27H23ClF6N2O4 — CID 73301268
2-(6-chloro-3-pyridinyl)-1-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-(3-methoxyphenoxy)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]ethanone (PubChem CID 73301268) has the molecular formula C27H23ClF6N2O4 and a molecular weight of 588.93 g/mol. Its IUPAC name is 2-(6-chloro-3-pyridinyl)-1-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-(3-methoxyphenoxy)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]ethanone.
| Compound Name | 2-(6-chloro-3-pyridinyl)-1-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-(3-methoxyphenoxy)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]ethanone |
|---|---|
| PubChem CID | 73301268 |
| Molecular Formula | C27H23ClF6N2O4 |
| Molecular Weight | 588.93 g/mol |
| Exact Mass | 588.13 |
| IUPAC Name | 2-(6-chloro-3-pyridinyl)-1-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-(3-methoxyphenoxy)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]ethanone |
| SMILES | COc1cccc(OC2CCc3cc(C(O)(C(F)(F)F)C(F)(F)F)ccc3N(C(=O)Cc3ccc(Cl)nc3)C2)c1 |
| InChI | InChI=1S/C27H23ClF6N2O4/c1-39-19-3-2-4-20(13-19)40-21-8-6-17-12-18(25(38,26(29,30)31)27(32,33)34)7-9-22(17)36(15-21)24(37)11-16-5-10-23(28)35-14-16/h2-5,7,9-10,12-14,21,38H,6,8,11,15H2,1H3 |
| InChIKey | UBGHXFSNVLMFLG-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.93 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|