C31H43NO8 — CID 73307256
[11-ethyl-6,8,17-trihydroxy-16-methoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] 4-methoxybenzoate (PubChem CID 73307256) has the molecular formula C31H43NO8 and a molecular weight of 557.68 g/mol. Its IUPAC name is [11-ethyl-6,8,17-trihydroxy-16-methoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] 4-methoxybenzoate.
| Compound Name | [11-ethyl-6,8,17-trihydroxy-16-methoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 73307256 |
| Molecular Formula | C31H43NO8 |
| Molecular Weight | 557.68 g/mol |
| Exact Mass | 557.30 |
| IUPAC Name | [11-ethyl-6,8,17-trihydroxy-16-methoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] 4-methoxybenzoate |
| SMILES | CCN1CC2(COC)CCC(OC)C34C5CC6C(O)CC(O)(C(CC23O)C14)C5C6OC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C31H43NO8/c1-5-32-15-28(16-37-2)11-10-23(39-4)31-20-12-19-22(33)14-29(35,21(26(31)32)13-30(28,31)36)24(20)25(19)40-27(34)17-6-8-18(38-3)9-7-17/h6-9,19-26,33,35-36H,5,10-16H2,1-4H3 |
| InChIKey | PDUVVYYRCZCJDU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 117.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.68 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |