C19H18BrN2O2+ — CID 7330828
4-bromo-5-methyl-1-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)indole-2,3-dione (PubChem CID 7330828) has the molecular formula C19H18BrN2O2+ and a molecular weight of 386.27 g/mol. Its IUPAC name is 4-bromo-5-methyl-1-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)indole-2,3-dione.
| Compound Name | 4-bromo-5-methyl-1-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)indole-2,3-dione |
|---|---|
| PubChem CID | 7330828 |
| Molecular Formula | C19H18BrN2O2+ |
| Molecular Weight | 386.27 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 4-bromo-5-methyl-1-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)indole-2,3-dione |
| SMILES | Cc1ccc2c(c1Br)C(=O)C(=O)N2C[NH+]1CCc2ccccc2C1 |
| InChI | InChI=1S/C19H17BrN2O2/c1-12-6-7-15-16(17(12)20)18(23)19(24)22(15)11-21-9-8-13-4-2-3-5-14(13)10-21/h2-7H,8-11H2,1H3/p+1 |
| InChIKey | LLHRSCNKJFTKTD-UHFFFAOYSA-O |
| XLogP | 1.89 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|