C15H24O4 — CID 73310738
1,9,9a-trimethyl-2,3a,4,5,7,8,9,9b-octahydrobenzo[e][1]benzofuran-1,2,7-triol (PubChem CID 73310738) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is 1,9,9a-trimethyl-2,3a,4,5,7,8,9,9b-octahydrobenzo[e][1]benzofuran-1,2,7-triol.
| Compound Name | 1,9,9a-trimethyl-2,3a,4,5,7,8,9,9b-octahydrobenzo[e][1]benzofuran-1,2,7-triol |
|---|---|
| PubChem CID | 73310738 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 1,9,9a-trimethyl-2,3a,4,5,7,8,9,9b-octahydrobenzo[e][1]benzofuran-1,2,7-triol |
| SMILES | CC1CC(O)C=C2CCC3OC(O)C(C)(O)C3C21C |
| InChI | InChI=1S/C15H24O4/c1-8-6-10(16)7-9-4-5-11-12(14(8,9)2)15(3,18)13(17)19-11/h7-8,10-13,16-18H,4-6H2,1-3H3 |
| InChIKey | FSKATUVMXYAJEV-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|