About 6-methyl-10-methylidenetricyclo[7.2.1.01,6]dodec-2-en-7-one
6-methyl-10-methylidenetricyclo[7.2.1.01,6]dodec-2-en-7-one (PubChem CID 73311102) has the molecular formula C14H18O
and a molecular weight of 202.30 g/mol. Its IUPAC name is 6-methyl-10-methylidenetricyclo[7.2.1.01,6]dodec-2-en-7-one.
Molecular Properties
| Compound Name | 6-methyl-10-methylidenetricyclo[7.2.1.01,6]dodec-2-en-7-one |
| PubChem CID | 73311102 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 6-methyl-10-methylidenetricyclo[7.2.1.01,6]dodec-2-en-7-one |
| SMILES | C=C1CC23C=CCCC2(C)C(=O)CC1C3 |
| InChI | InChI=1S/C14H18O/c1-10-8-14-6-4-3-5-13(14,2)12(15)7-11(10)9-14/h4,6,11H,1,3,5,7-9H2,2H3 |
| InChIKey | ATZGRQGWBVGVFK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-10-methylidenetricyclo[7.2.1.01,6]dodec-2-en-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-10-methylidenetricyclo[7.2.1.01,6]dodec-2-en-7-one?
The IUPAC name of 6-methyl-10-methylidenetricyclo[7.2.1.01,6]dodec-2-en-7-one (CID 73311102) is 6-methyl-10-methylidenetricyclo[7.2.1.01,6]dodec-2-en-7-one.
What is the SMILES notation for 6-methyl-10-methylidenetricyclo[7.2.1.01,6]dodec-2-en-7-one?
The canonical SMILES for 6-methyl-10-methylidenetricyclo[7.2.1.01,6]dodec-2-en-7-one is C=C1CC23C=CCCC2(C)C(=O)CC1C3.
What is the InChIKey of 6-methyl-10-methylidenetricyclo[7.2.1.01,6]dodec-2-en-7-one?
The InChIKey is ATZGRQGWBVGVFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O/c1-10-8-14-6-4-3-5-13(14,2)12(15)7-11(10)9-14/h4,6,11H,1,3,5,7-9H2,2H3.
What are the key properties of 6-methyl-10-methylidenetricyclo[7.2.1.01,6]dodec-2-en-7-one?
6-methyl-10-methylidenetricyclo[7.2.1.01,6]dodec-2-en-7-one has a molecular weight of 202.30 g/mol, XLogP of 3.27, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-10-methylidenetricyclo[7.2.1.01,6]dodec-2-en-7-one is sourced from PubChem (CID 73311102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).