C35H44O12 — CID 73312230
[11-acetyloxy-13-hydroxy-7,21,21-trimethyl-8-(4-methyl-5-oxo-2H-furan-2-yl)-17-oxo-3,9,16,20-tetraoxaheptacyclo[11.11.0.02,4.02,10.06,10.015,19.015,22]tetracosan-24-yl] 2-methylbut-2-enoate (PubChem CID 73312230) has the molecular formula C35H44O12 and a molecular weight of 656.73 g/mol. Its IUPAC name is [11-acetyloxy-13-hydroxy-7,21,21-trimethyl-8-(4-methyl-5-oxo-2H-furan-2-yl)-17-oxo-3,9,16,20-tetraoxaheptacyclo[11.11.0.02,4.02,10.06,10.015,19.015,22]tetracosan-24-yl] 2-methylbut-2-enoate.
| Compound Name | [11-acetyloxy-13-hydroxy-7,21,21-trimethyl-8-(4-methyl-5-oxo-2H-furan-2-yl)-17-oxo-3,9,16,20-tetraoxaheptacyclo[11.11.0.02,4.02,10.06,10.015,19.015,22]tetracosan-24-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 73312230 |
| Molecular Formula | C35H44O12 |
| Molecular Weight | 656.73 g/mol |
| Exact Mass | 656.28 |
| IUPAC Name | [11-acetyloxy-13-hydroxy-7,21,21-trimethyl-8-(4-methyl-5-oxo-2H-furan-2-yl)-17-oxo-3,9,16,20-tetraoxaheptacyclo[11.11.0.02,4.02,10.06,10.015,19.015,22]tetracosan-24-yl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1CC2C(C)(C)OC3CC(=O)OC32CC2(O)CC(OC(C)=O)C34OC(C5C=C(C)C(=O)O5)C(C)C3CC3OC34C12 |
| InChI | InChI=1S/C35H44O12/c1-8-15(2)29(38)43-21-11-22-31(6,7)44-23-12-26(37)46-33(22,23)14-32(40)13-25(41-18(5)36)34-19(10-24-35(34,45-24)28(21)32)17(4)27(47-34)20-9-16(3)30(39)42-20/h8-9,17,19-25,27-28,40H,10-14H2,1-7H3 |
| InChIKey | NUZPZGFCRDRLEI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 156.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.73 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|