About 10-(dimethylamino)-3,7-dimethyldeca-2,6-dien-1-ol
10-(dimethylamino)-3,7-dimethyldeca-2,6-dien-1-ol (PubChem CID 73313332) has the molecular formula C14H27NO
and a molecular weight of 225.38 g/mol. Its IUPAC name is 10-(dimethylamino)-3,7-dimethyldeca-2,6-dien-1-ol.
Molecular Properties
| Compound Name | 10-(dimethylamino)-3,7-dimethyldeca-2,6-dien-1-ol |
| PubChem CID | 73313332 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | 10-(dimethylamino)-3,7-dimethyldeca-2,6-dien-1-ol |
| SMILES | CC(=CCO)CCC=C(C)CCCN(C)C |
| InChI | InChI=1S/C14H27NO/c1-13(9-6-11-15(3)4)7-5-8-14(2)10-12-16/h7,10,16H,5-6,8-9,11-12H2,1-4H3 |
| InChIKey | DHLUBBQTPDVPMM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 10-(dimethylamino)-3,7-dimethyldeca-2,6-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(dimethylamino)-3,7-dimethyldeca-2,6-dien-1-ol?
The IUPAC name of 10-(dimethylamino)-3,7-dimethyldeca-2,6-dien-1-ol (CID 73313332) is 10-(dimethylamino)-3,7-dimethyldeca-2,6-dien-1-ol.
What is the SMILES notation for 10-(dimethylamino)-3,7-dimethyldeca-2,6-dien-1-ol?
The canonical SMILES for 10-(dimethylamino)-3,7-dimethyldeca-2,6-dien-1-ol is CC(=CCO)CCC=C(C)CCCN(C)C.
What is the InChIKey of 10-(dimethylamino)-3,7-dimethyldeca-2,6-dien-1-ol?
The InChIKey is DHLUBBQTPDVPMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO/c1-13(9-6-11-15(3)4)7-5-8-14(2)10-12-16/h7,10,16H,5-6,8-9,11-12H2,1-4H3.
What are the key properties of 10-(dimethylamino)-3,7-dimethyldeca-2,6-dien-1-ol?
10-(dimethylamino)-3,7-dimethyldeca-2,6-dien-1-ol has a molecular weight of 225.38 g/mol, XLogP of 2.99, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(dimethylamino)-3,7-dimethyldeca-2,6-dien-1-ol is sourced from PubChem (CID 73313332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).