C17H12N5OS+ — CID 7331405
12-amino-10-(3-methylphenyl)-8-oxo-5-thia-7,13-diaza-2-azoniatricyclo[7.4.0.02,6]trideca-1(9),2(6),3,10,12-pentaene-11-carbonitrile (PubChem CID 7331405) has the molecular formula C17H12N5OS+ and a molecular weight of 334.38 g/mol. Its IUPAC name is 12-amino-10-(3-methylphenyl)-8-oxo-5-thia-7,13-diaza-2-azoniatricyclo[7.4.0.02,6]trideca-1(9),2(6),3,10,12-pentaene-11-carbonitrile.
| Compound Name | 12-amino-10-(3-methylphenyl)-8-oxo-5-thia-7,13-diaza-2-azoniatricyclo[7.4.0.02,6]trideca-1(9),2(6),3,10,12-pentaene-11-carbonitrile |
|---|---|
| PubChem CID | 7331405 |
| Molecular Formula | C17H12N5OS+ |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 12-amino-10-(3-methylphenyl)-8-oxo-5-thia-7,13-diaza-2-azoniatricyclo[7.4.0.02,6]trideca-1(9),2(6),3,10,12-pentaene-11-carbonitrile |
| SMILES | Cc1cccc(-c2c(C#N)c(N)nc3c2c(=O)[nH]c2scc[n+]23)c1 |
| InChI | InChI=1S/C17H11N5OS/c1-9-3-2-4-10(7-9)12-11(8-18)14(19)20-15-13(12)16(23)21-17-22(15)5-6-24-17/h2-7H,1H3,(H2,19,20,23)/p+1 |
| InChIKey | DVRXUFZFWVQDOF-UHFFFAOYSA-O |
| XLogP | 2.15 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|