About ethyl 5-hydroxyhept-6-enoate
ethyl 5-hydroxyhept-6-enoate (PubChem CID 73317003) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is ethyl 5-hydroxyhept-6-enoate.
Molecular Properties
| Compound Name | ethyl 5-hydroxyhept-6-enoate |
| PubChem CID | 73317003 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | ethyl 5-hydroxyhept-6-enoate |
| SMILES | C=CC(O)CCCC(=O)OCC |
| InChI | InChI=1S/C9H16O3/c1-3-8(10)6-5-7-9(11)12-4-2/h3,8,10H,1,4-7H2,2H3 |
| InChIKey | XRAQPBQUKLEMCD-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-hydroxyhept-6-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-hydroxyhept-6-enoate?
The IUPAC name of ethyl 5-hydroxyhept-6-enoate (CID 73317003) is ethyl 5-hydroxyhept-6-enoate.
What is the SMILES notation for ethyl 5-hydroxyhept-6-enoate?
The canonical SMILES for ethyl 5-hydroxyhept-6-enoate is C=CC(O)CCCC(=O)OCC.
What is the InChIKey of ethyl 5-hydroxyhept-6-enoate?
The InChIKey is XRAQPBQUKLEMCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3/c1-3-8(10)6-5-7-9(11)12-4-2/h3,8,10H,1,4-7H2,2H3.
What are the key properties of ethyl 5-hydroxyhept-6-enoate?
ethyl 5-hydroxyhept-6-enoate has a molecular weight of 172.22 g/mol, XLogP of 1.27, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-hydroxyhept-6-enoate is sourced from PubChem (CID 73317003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).