C24H37NO7 — CID 73318688
14-ethyl-4,6,19-trimethoxy-9,11-dioxa-14-azaheptacyclo[10.7.2.12,5.01,13.03,8.08,12.016,20]docosane-2,21-diol (PubChem CID 73318688) has the molecular formula C24H37NO7 and a molecular weight of 451.56 g/mol. Its IUPAC name is 14-ethyl-4,6,19-trimethoxy-9,11-dioxa-14-azaheptacyclo[10.7.2.12,5.01,13.03,8.08,12.016,20]docosane-2,21-diol.
| Compound Name | 14-ethyl-4,6,19-trimethoxy-9,11-dioxa-14-azaheptacyclo[10.7.2.12,5.01,13.03,8.08,12.016,20]docosane-2,21-diol |
|---|---|
| PubChem CID | 73318688 |
| Molecular Formula | C24H37NO7 |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | 14-ethyl-4,6,19-trimethoxy-9,11-dioxa-14-azaheptacyclo[10.7.2.12,5.01,13.03,8.08,12.016,20]docosane-2,21-diol |
| SMILES | CCN1CC2CCC(OC)C34C2C(O)C2(OCOC25CC(OC)C2CC3(O)C5C2OC)C14 |
| InChI | InChI=1S/C24H37NO7/c1-5-25-10-12-6-7-15(29-3)23-16(12)19(26)24(20(23)25)22(31-11-32-24)9-14(28-2)13-8-21(23,27)18(22)17(13)30-4/h12-20,26-27H,5-11H2,1-4H3 |
| InChIKey | QAZPSWHJMBKART-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |