About 6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-amine
6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-amine (PubChem CID 733193) has the molecular formula C5H6N4S
and a molecular weight of 154.20 g/mol. Its IUPAC name is 6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-amine.
Analyze 6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-amine?
The IUPAC name of 6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-amine (CID 733193) is 6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-amine.
What is the SMILES notation for 6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-amine?
The canonical SMILES for 6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-amine is Cc1csc2nc(N)nn12.
What is the InChIKey of 6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-amine?
The InChIKey is CQMXVRSRZTVQPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N4S/c1-3-2-10-5-7-4(6)8-9(3)5/h2H,1H3,(H2,6,8).
What are the key properties of 6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-amine?
6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-amine has a molecular weight of 154.20 g/mol, XLogP of 0.68, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-amine is sourced from PubChem (CID 733193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).