C19H15NO10 — CID 73320084
2-[3-[3-methoxy-4-(2-nitrooxyacetyl)oxyphenyl]prop-2-enoyloxy]benzoic acid (PubChem CID 73320084) has the molecular formula C19H15NO10 and a molecular weight of 417.33 g/mol. Its IUPAC name is 2-[3-[3-methoxy-4-(2-nitrooxyacetyl)oxyphenyl]prop-2-enoyloxy]benzoic acid.
| Compound Name | 2-[3-[3-methoxy-4-(2-nitrooxyacetyl)oxyphenyl]prop-2-enoyloxy]benzoic acid |
|---|---|
| PubChem CID | 73320084 |
| Molecular Formula | C19H15NO10 |
| Molecular Weight | 417.33 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | 2-[3-[3-methoxy-4-(2-nitrooxyacetyl)oxyphenyl]prop-2-enoyloxy]benzoic acid |
| SMILES | COc1cc(C=CC(=O)Oc2ccccc2C(=O)O)ccc1OC(=O)CO[N+](=O)[O-] |
| InChI | InChI=1S/C19H15NO10/c1-27-16-10-12(6-8-15(16)30-18(22)11-28-20(25)26)7-9-17(21)29-14-5-3-2-4-13(14)19(23)24/h2-10H,11H2,1H3,(H,23,24) |
| InChIKey | SZWKUSVKLWRISW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 151.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|