About 4-methyl-3,8-dioxatricyclo[5.1.0.02,4]oct-5-ene
4-methyl-3,8-dioxatricyclo[5.1.0.02,4]oct-5-ene (PubChem CID 73320957) has the molecular formula C7H8O2
and a molecular weight of 124.14 g/mol. Its IUPAC name is 4-methyl-3,8-dioxatricyclo[5.1.0.02,4]oct-5-ene.
Molecular Properties
| Compound Name | 4-methyl-3,8-dioxatricyclo[5.1.0.02,4]oct-5-ene |
| PubChem CID | 73320957 |
| Molecular Formula | C7H8O2 |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.05 |
| IUPAC Name | 4-methyl-3,8-dioxatricyclo[5.1.0.02,4]oct-5-ene |
| SMILES | CC12C=CC3OC3C1O2 |
| InChI | InChI=1S/C7H8O2/c1-7-3-2-4-5(8-4)6(7)9-7/h2-6H,1H3 |
| InChIKey | KJTMISGJGGEMPR-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-3,8-dioxatricyclo[5.1.0.02,4]oct-5-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3,8-dioxatricyclo[5.1.0.02,4]oct-5-ene?
The IUPAC name of 4-methyl-3,8-dioxatricyclo[5.1.0.02,4]oct-5-ene (CID 73320957) is 4-methyl-3,8-dioxatricyclo[5.1.0.02,4]oct-5-ene.
What is the SMILES notation for 4-methyl-3,8-dioxatricyclo[5.1.0.02,4]oct-5-ene?
The canonical SMILES for 4-methyl-3,8-dioxatricyclo[5.1.0.02,4]oct-5-ene is CC12C=CC3OC3C1O2.
What is the InChIKey of 4-methyl-3,8-dioxatricyclo[5.1.0.02,4]oct-5-ene?
The InChIKey is KJTMISGJGGEMPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2/c1-7-3-2-4-5(8-4)6(7)9-7/h2-6H,1H3.
What are the key properties of 4-methyl-3,8-dioxatricyclo[5.1.0.02,4]oct-5-ene?
4-methyl-3,8-dioxatricyclo[5.1.0.02,4]oct-5-ene has a molecular weight of 124.14 g/mol, XLogP of 0.48, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3,8-dioxatricyclo[5.1.0.02,4]oct-5-ene is sourced from PubChem (CID 73320957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).